C22H24ClNO5 — CID 155138097
methyl 4-[(1S,3S)-2-(2-chloroacetyl)-6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]benzoate (PubChem CID 155138097) has the molecular formula C22H24ClNO5 and a molecular weight of 417.89 g/mol. Its IUPAC name is methyl 4-[(1S,3S)-2-(2-chloroacetyl)-6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]benzoate.
| Compound Name | methyl 4-[(1S,3S)-2-(2-chloroacetyl)-6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]benzoate |
|---|---|
| PubChem CID | 155138097 |
| Molecular Formula | C22H24ClNO5 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | methyl 4-[(1S,3S)-2-(2-chloroacetyl)-6,7-dimethoxy-3-methyl-3,4-dihydro-1H-isoquinolin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2c3cc(OC)c(OC)cc3C[C@H](C)N2C(=O)CCl)cc1 |
| InChI | InChI=1S/C22H24ClNO5/c1-13-9-16-10-18(27-2)19(28-3)11-17(16)21(24(13)20(25)12-23)14-5-7-15(8-6-14)22(26)29-4/h5-8,10-11,13,21H,9,12H2,1-4H3/t13-,21-/m0/s1 |
| InChIKey | RANYGDGHMPTTKV-ZSEKCTLFSA-N |
| XLogP | 3.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|