C23H26ClNO5 — CID 51031359
tert-butyl (1S,3S)-1-(4-chlorophenyl)-3-formyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 51031359) has the molecular formula C23H26ClNO5 and a molecular weight of 431.92 g/mol. Its IUPAC name is tert-butyl (1S,3S)-1-(4-chlorophenyl)-3-formyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (1S,3S)-1-(4-chlorophenyl)-3-formyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 51031359 |
| Molecular Formula | C23H26ClNO5 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | tert-butyl (1S,3S)-1-(4-chlorophenyl)-3-formyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccc(Cl)cc1)N(C(=O)OC(C)(C)C)[C@H](C=O)C2 |
| InChI | InChI=1S/C23H26ClNO5/c1-23(2,3)30-22(27)25-17(13-26)10-15-11-19(28-4)20(29-5)12-18(15)21(25)14-6-8-16(24)9-7-14/h6-9,11-13,17,21H,10H2,1-5H3/t17-,21-/m0/s1 |
| InChIKey | SYAJFAXZWXDAQK-UWJYYQICSA-N |
| XLogP | 4.81 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|