C26H27Cl2NO4 — CID 58952382
tert-butyl (3aS,6R,7S,7aS)-6-(4-chloro-2-methoxyphenyl)-7-(4-chlorophenyl)-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate (PubChem CID 58952382) has the molecular formula C26H27Cl2NO4 and a molecular weight of 488.41 g/mol. Its IUPAC name is tert-butyl (3aS,6R,7S,7aS)-6-(4-chloro-2-methoxyphenyl)-7-(4-chlorophenyl)-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6R,7S,7aS)-6-(4-chloro-2-methoxyphenyl)-7-(4-chlorophenyl)-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 58952382 |
| Molecular Formula | C26H27Cl2NO4 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | tert-butyl (3aS,6R,7S,7aS)-6-(4-chloro-2-methoxyphenyl)-7-(4-chlorophenyl)-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate |
| SMILES | COc1cc(Cl)ccc1[C@@H]1C=C[C@@H]2C(=O)N(C(=O)OC(C)(C)C)C[C@H]2[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27Cl2NO4/c1-26(2,3)33-25(31)29-14-21-20(24(29)30)12-11-19(18-10-9-17(28)13-22(18)32-4)23(21)15-5-7-16(27)8-6-15/h5-13,19-21,23H,14H2,1-4H3/t19-,20-,21+,23-/m0/s1 |
| InChIKey | UTLREKUDWFDJAC-QXUYBEEESA-N |
| XLogP | 6.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|