C26H27Cl2NO3 — CID 58952405
tert-butyl (3aS,6S,7S,7aS)-6,7-bis(4-chlorophenyl)-5-methyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate (PubChem CID 58952405) has the molecular formula C26H27Cl2NO3 and a molecular weight of 472.41 g/mol. Its IUPAC name is tert-butyl (3aS,6S,7S,7aS)-6,7-bis(4-chlorophenyl)-5-methyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6S,7S,7aS)-6,7-bis(4-chlorophenyl)-5-methyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate |
|---|---|
| PubChem CID | 58952405 |
| Molecular Formula | C26H27Cl2NO3 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | tert-butyl (3aS,6S,7S,7aS)-6,7-bis(4-chlorophenyl)-5-methyl-3-oxo-3a,6,7,7a-tetrahydro-1H-isoindole-2-carboxylate |
| SMILES | CC1=C[C@@H]2C(=O)N(C(=O)OC(C)(C)C)C[C@H]2[C@@H](c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C26H27Cl2NO3/c1-15-13-20-21(14-29(24(20)30)25(31)32-26(2,3)4)23(17-7-11-19(28)12-8-17)22(15)16-5-9-18(27)10-6-16/h5-13,20-23H,14H2,1-4H3/t20-,21+,22-,23+/m0/s1 |
| InChIKey | BRTOYPHTOQCAOS-GSPCLOLRSA-N |
| XLogP | 6.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|