C25H25N3O5 — CID 73232088
N-[6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]benzamide (PubChem CID 73232088) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-[6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]benzamide.
| Compound Name | N-[6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]benzamide |
|---|---|
| PubChem CID | 73232088 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[6,7-dimethoxy-3-methyl-1-(4-nitrophenyl)-3,4-dihydro-1H-isoquinolin-2-yl]benzamide |
| SMILES | COc1cc2c(cc1OC)C(c1ccc([N+](=O)[O-])cc1)N(NC(=O)c1ccccc1)C(C)C2 |
| InChI | InChI=1S/C25H25N3O5/c1-16-13-19-14-22(32-2)23(33-3)15-21(19)24(17-9-11-20(12-10-17)28(30)31)27(16)26-25(29)18-7-5-4-6-8-18/h4-12,14-16,24H,13H2,1-3H3,(H,26,29) |
| InChIKey | JDOCFGOFCKRTTI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|