C26H25N3O8 — CID 42502880
N-[(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-oxo-1,4-dihydroisoquinolin-2-yl]-4-nitrobenzamide (PubChem CID 42502880) has the molecular formula C26H25N3O8 and a molecular weight of 507.50 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-oxo-1,4-dihydroisoquinolin-2-yl]-4-nitrobenzamide.
| Compound Name | N-[(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-oxo-1,4-dihydroisoquinolin-2-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 42502880 |
| Molecular Formula | C26H25N3O8 |
| Molecular Weight | 507.50 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | N-[(1S)-1-(3,4-dimethoxyphenyl)-6,7-dimethoxy-3-oxo-1,4-dihydroisoquinolin-2-yl]-4-nitrobenzamide |
| SMILES | COc1ccc([C@H]2c3cc(OC)c(OC)cc3CC(=O)N2NC(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C26H25N3O8/c1-34-20-10-7-16(11-21(20)35-2)25-19-14-23(37-4)22(36-3)12-17(19)13-24(30)28(25)27-26(31)15-5-8-18(9-6-15)29(32)33/h5-12,14,25H,13H2,1-4H3,(H,27,31)/t25-/m0/s1 |
| InChIKey | BYHOKXPCNPLDFP-VWLOTQADSA-N |
| XLogP | 3.45 |
| TPSA | 129.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|