C21H22N4O5S — CID 90903222
2-[(1S,4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-1,2,4,5-tetrahydro-2,3-benzodiazepin-3-yl]-1,3-thiazol-4-ol (PubChem CID 90903222) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is 2-[(1S,4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-1,2,4,5-tetrahydro-2,3-benzodiazepin-3-yl]-1,3-thiazol-4-ol.
| Compound Name | 2-[(1S,4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-1,2,4,5-tetrahydro-2,3-benzodiazepin-3-yl]-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 90903222 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 2-[(1S,4R)-7,8-dimethoxy-4-methyl-1-(4-nitrophenyl)-1,2,4,5-tetrahydro-2,3-benzodiazepin-3-yl]-1,3-thiazol-4-ol |
| SMILES | COc1cc2c(cc1OC)[C@H](c1ccc([N+](=O)[O-])cc1)NN(c1nc(O)cs1)[C@H](C)C2 |
| InChI | InChI=1S/C21H22N4O5S/c1-12-8-14-9-17(29-2)18(30-3)10-16(14)20(13-4-6-15(7-5-13)25(27)28)23-24(12)21-22-19(26)11-31-21/h4-7,9-12,20,23,26H,8H2,1-3H3/t12-,20+/m1/s1 |
| InChIKey | RJGHMKALSXUTNQ-ODXCJYRJSA-N |
| XLogP | 3.82 |
| TPSA | 109.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|