C26H37N3O3 — CID 155138263
pentyl N-[4-[(1S,3R)-3-(butylamino)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]carbamate (PubChem CID 155138263) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is pentyl N-[4-[(1S,3R)-3-(butylamino)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]carbamate.
| Compound Name | pentyl N-[4-[(1S,3R)-3-(butylamino)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 155138263 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | pentyl N-[4-[(1S,3R)-3-(butylamino)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]carbamate |
| SMILES | CCCCCOC(=O)Nc1ccc([C@@H]2N[C@@H](NCCCC)Cc3cc(OC)ccc32)cc1 |
| InChI | InChI=1S/C26H37N3O3/c1-4-6-8-16-32-26(30)28-21-11-9-19(10-12-21)25-23-14-13-22(31-3)17-20(23)18-24(29-25)27-15-7-5-2/h9-14,17,24-25,27,29H,4-8,15-16,18H2,1-3H3,(H,28,30)/t24-,25+/m1/s1 |
| InChIKey | DLBOOIHRWOXNCN-RPBOFIJWSA-N |
| XLogP | 5.38 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|