C20H34O2 — CID 155138791
(2R,3aR,5aR,8R,9aS)-2-[(Z)-but-2-en-2-yl]-2,3a,5,5,8-pentamethyl-4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole (PubChem CID 155138791) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (2R,3aR,5aR,8R,9aS)-2-[(Z)-but-2-en-2-yl]-2,3a,5,5,8-pentamethyl-4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole.
| Compound Name | (2R,3aR,5aR,8R,9aS)-2-[(Z)-but-2-en-2-yl]-2,3a,5,5,8-pentamethyl-4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole |
|---|---|
| PubChem CID | 155138791 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (2R,3aR,5aR,8R,9aS)-2-[(Z)-but-2-en-2-yl]-2,3a,5,5,8-pentamethyl-4,5a,6,7,8,8a,9,9a-octahydroazuleno[5,6-d][1,3]dioxole |
| SMILES | C/C=C(/C)[C@]1(C)O[C@H]2CC3[C@H](C)CC[C@H]3C(C)(C)C[C@@]2(C)O1 |
| InChI | InChI=1S/C20H34O2/c1-8-14(3)20(7)21-17-11-15-13(2)9-10-16(15)18(4,5)12-19(17,6)22-20/h8,13,15-17H,9-12H2,1-7H3/b14-8-/t13-,15?,16-,17+,19-,20-/m1/s1 |
| InChIKey | HCEUZOIADPRLIX-FPQALJSBSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|