C13H13N3O5 — CID 155142425
2,2-dideuterio-N-methyl-2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)oxyacetamide (PubChem CID 155142425) has the molecular formula C13H13N3O5 and a molecular weight of 293.28 g/mol. Its IUPAC name is 2,2-dideuterio-N-methyl-2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)oxyacetamide.
| Compound Name | 2,2-dideuterio-N-methyl-2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 155142425 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 2,2-dideuterio-N-methyl-2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)oxyacetamide |
| SMILES | [2H]C([2H])(Oc1cc2cc([N+](=O)[O-])ccc2n(C)c1=O)C(=O)NC |
| InChI | InChI=1S/C13H13N3O5/c1-14-12(17)7-21-11-6-8-5-9(16(19)20)3-4-10(8)15(2)13(11)18/h3-6H,7H2,1-2H3,(H,14,17)/i7D2 |
| InChIKey | NRSVYPGIXWHDHS-RJSZUWSASA-N |
| XLogP | 0.57 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|