C26H26N4O8S2 — CID 159910472
methyl 2-(6-amino-1-methyl-2-oxoquinolin-3-yl)sulfanylacetate;methyl 2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)sulfanylacetate (PubChem CID 159910472) has the molecular formula C26H26N4O8S2 and a molecular weight of 586.65 g/mol. Its IUPAC name is methyl 2-(6-amino-1-methyl-2-oxoquinolin-3-yl)sulfanylacetate;methyl 2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)sulfanylacetate.
| Compound Name | methyl 2-(6-amino-1-methyl-2-oxoquinolin-3-yl)sulfanylacetate;methyl 2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)sulfanylacetate |
|---|---|
| PubChem CID | 159910472 |
| Molecular Formula | C26H26N4O8S2 |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | methyl 2-(6-amino-1-methyl-2-oxoquinolin-3-yl)sulfanylacetate;methyl 2-(1-methyl-6-nitro-2-oxoquinolin-3-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1cc2cc(N)ccc2n(C)c1=O.COC(=O)CSc1cc2cc([N+](=O)[O-])ccc2n(C)c1=O |
| InChI | InChI=1S/C13H12N2O5S.C13H14N2O3S/c1-14-10-4-3-9(15(18)19)5-8(10)6-11(13(14)17)21-7-12(16)20-2;1-15-10-4-3-9(14)5-8(10)6-11(13(15)17)19-7-12(16)18-2/h3-6H,7H2,1-2H3;3-6H,7,14H2,1-2H3 |
| InChIKey | NXCURKYRQGJMJV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 165.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|