C13H11N3O4 — CID 122233175
1-(1-methyl-5-nitroindol-2-yl)pyrrolidine-2,5-dione (PubChem CID 122233175) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 1-(1-methyl-5-nitroindol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(1-methyl-5-nitroindol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 122233175 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 1-(1-methyl-5-nitroindol-2-yl)pyrrolidine-2,5-dione |
| SMILES | Cn1c(N2C(=O)CCC2=O)cc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C13H11N3O4/c1-14-10-3-2-9(16(19)20)6-8(10)7-11(14)15-12(17)4-5-13(15)18/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | GOIJPXDBPMBCIQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 85.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|