C23H23FN4O2 — CID 155143614
2-[(E)-cyclopropyloxyiminomethyl]-6-fluoro-4-[1-(4-pyrrolidin-1-ylphenyl)pyrazol-4-yl]phenol (PubChem CID 155143614) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-[(E)-cyclopropyloxyiminomethyl]-6-fluoro-4-[1-(4-pyrrolidin-1-ylphenyl)pyrazol-4-yl]phenol.
| Compound Name | 2-[(E)-cyclopropyloxyiminomethyl]-6-fluoro-4-[1-(4-pyrrolidin-1-ylphenyl)pyrazol-4-yl]phenol |
|---|---|
| PubChem CID | 155143614 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 2-[(E)-cyclopropyloxyiminomethyl]-6-fluoro-4-[1-(4-pyrrolidin-1-ylphenyl)pyrazol-4-yl]phenol |
| SMILES | Oc1c(F)cc(-c2cnn(-c3ccc(N4CCCC4)cc3)c2)cc1/C=N/OC1CC1 |
| InChI | InChI=1S/C23H23FN4O2/c24-22-12-16(11-17(23(22)29)14-26-30-21-7-8-21)18-13-25-28(15-18)20-5-3-19(4-6-20)27-9-1-2-10-27/h3-6,11-15,21,29H,1-2,7-10H2/b26-14+ |
| InChIKey | UWEDFHJTCQOVNK-VULFUBBASA-N |
| XLogP | 4.50 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|