About 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide
4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide (PubChem CID 155144480) has the molecular formula C13H15N5OS
and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide.
Molecular Properties
| Compound Name | 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide |
| PubChem CID | 155144480 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide |
| SMILES | COc1ccc(/C(N)=N/C(N)=N/c2nc(C)cs2)cc1 |
| InChI | InChI=1S/C13H15N5OS/c1-8-7-20-13(16-8)18-12(15)17-11(14)9-3-5-10(19-2)6-4-9/h3-7H,1-2H3,(H4,14,15,16,17,18) |
| InChIKey | QLUNFPMLXSZKJB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide?
The IUPAC name of 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide (CID 155144480) is 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide.
What is the SMILES notation for 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide?
The canonical SMILES for 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide is COc1ccc(/C(N)=N/C(N)=N/c2nc(C)cs2)cc1.
What is the InChIKey of 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide?
The InChIKey is QLUNFPMLXSZKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5OS/c1-8-7-20-13(16-8)18-12(15)17-11(14)9-3-5-10(19-2)6-4-9/h3-7H,1-2H3,(H4,14,15,16,17,18).
What are the key properties of 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide?
4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide has a molecular weight of 289.36 g/mol, XLogP of 1.81, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N'-[(E)-N'-(4-methyl-1,3-thiazol-2-yl)carbamimidoyl]benzenecarboximidamide is sourced from PubChem (CID 155144480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).