C30H20Cl4N10S2 — CID 155144503
2-N-[2-[[2-[[4-amino-6-(2,6-dichlorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(2,6-dichlorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 155144503) has the molecular formula C30H20Cl4N10S2 and a molecular weight of 726.51 g/mol. Its IUPAC name is 2-N-[2-[[2-[[4-amino-6-(2,6-dichlorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(2,6-dichlorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[[4-amino-6-(2,6-dichlorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(2,6-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 155144503 |
| Molecular Formula | C30H20Cl4N10S2 |
| Molecular Weight | 726.51 g/mol |
| Exact Mass | 724.01 |
| IUPAC Name | 2-N-[2-[[2-[[4-amino-6-(2,6-dichlorophenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(2,6-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccccc2SSc2ccccc2Nc2nc(N)nc(-c3c(Cl)cccc3Cl)n2)nc(-c2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C30H20Cl4N10S2/c31-15-7-5-8-16(32)23(15)25-39-27(35)43-29(41-25)37-19-11-1-3-13-21(19)45-46-22-14-4-2-12-20(22)38-30-42-26(40-28(36)44-30)24-17(33)9-6-10-18(24)34/h1-14H,(H3,35,37,39,41,43)(H3,36,38,40,42,44) |
| InChIKey | IZRHSAQXAQEBBO-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.51 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|