C15H8ClF3N2O3 — CID 155146083
6-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-4-cyanopyridine-2-carboxylic acid (PubChem CID 155146083) has the molecular formula C15H8ClF3N2O3 and a molecular weight of 356.69 g/mol. Its IUPAC name is 6-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-4-cyanopyridine-2-carboxylic acid.
| Compound Name | 6-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-4-cyanopyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 155146083 |
| Molecular Formula | C15H8ClF3N2O3 |
| Molecular Weight | 356.69 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 6-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-4-cyanopyridine-2-carboxylic acid |
| SMILES | N#Cc1cc(COc2ccc(C(F)(F)F)cc2Cl)nc(C(=O)O)c1 |
| InChI | InChI=1S/C15H8ClF3N2O3/c16-11-5-9(15(17,18)19)1-2-13(11)24-7-10-3-8(6-20)4-12(21-10)14(22)23/h1-5H,7H2,(H,22,23) |
| InChIKey | CTTDXRFDOVLKLZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 83.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |