C10H18IN — CID 155147769
(1R,4S)-3-tert-butyl-2-iodo-2-azabicyclo[2.2.1]heptane (PubChem CID 155147769) has the molecular formula C10H18IN and a molecular weight of 279.17 g/mol. Its IUPAC name is (1R,4S)-3-tert-butyl-2-iodo-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S)-3-tert-butyl-2-iodo-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 155147769 |
| Molecular Formula | C10H18IN |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | (1R,4S)-3-tert-butyl-2-iodo-2-azabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)C1[C@H]2CC[C@H](C2)N1I |
| InChI | InChI=1S/C10H18IN/c1-10(2,3)9-7-4-5-8(6-7)12(9)11/h7-9H,4-6H2,1-3H3/t7-,8+,9?/m0/s1 |
| InChIKey | BNXFRBBAYCSYOH-ZQTLJVIJSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|