C15H29N — CID 71075636
2,3-ditert-butyl-2-azabicyclo[2.2.2]octane (PubChem CID 71075636) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 2,3-ditert-butyl-2-azabicyclo[2.2.2]octane.
| Compound Name | 2,3-ditert-butyl-2-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 71075636 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2,3-ditert-butyl-2-azabicyclo[2.2.2]octane |
| SMILES | CC(C)(C)C1C2CCC(CC2)N1C(C)(C)C |
| InChI | InChI=1S/C15H29N/c1-14(2,3)13-11-7-9-12(10-8-11)16(13)15(4,5)6/h11-13H,7-10H2,1-6H3 |
| InChIKey | HZCJODHZRMSHMN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |