C13H25NO — CID 176747824
5,6-ditert-butyl-2-oxa-6-azabicyclo[2.2.1]heptane (PubChem CID 176747824) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 5,6-ditert-butyl-2-oxa-6-azabicyclo[2.2.1]heptane.
| Compound Name | 5,6-ditert-butyl-2-oxa-6-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 176747824 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 5,6-ditert-butyl-2-oxa-6-azabicyclo[2.2.1]heptane |
| SMILES | CC(C)(C)C1C2COC(C2)N1C(C)(C)C |
| InChI | InChI=1S/C13H25NO/c1-12(2,3)11-9-7-10(15-8-9)14(11)13(4,5)6/h9-11H,7-8H2,1-6H3 |
| InChIKey | LAWFGWLUSQOYNZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |