C27H29N5O4S2 — CID 155148107
methyl 5-[2-[2-[3-(2-methoxyethylamino)propanoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]-1,3-benzothiazol-5-yl]pyridine-2-carboxylate (PubChem CID 155148107) has the molecular formula C27H29N5O4S2 and a molecular weight of 551.69 g/mol. Its IUPAC name is methyl 5-[2-[2-[3-(2-methoxyethylamino)propanoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]-1,3-benzothiazol-5-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[2-[2-[3-(2-methoxyethylamino)propanoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]-1,3-benzothiazol-5-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 155148107 |
| Molecular Formula | C27H29N5O4S2 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | methyl 5-[2-[2-[3-(2-methoxyethylamino)propanoylamino]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-3-yl]-1,3-benzothiazol-5-yl]pyridine-2-carboxylate |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccc(C(=O)OC)nc4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C27H29N5O4S2/c1-35-12-11-28-10-8-23(33)32-26-24(18-7-9-29-15-22(18)38-26)25-31-20-13-16(4-6-21(20)37-25)17-3-5-19(30-14-17)27(34)36-2/h3-6,13-14,28-29H,7-12,15H2,1-2H3,(H,32,33) |
| InChIKey | AAORHZFGEVHJIL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|