C23H21ClF3N3O3 — CID 155148517
1-[4-[4-[[[4-chloro-3-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-2-pyridinyl]-2-methylpropan-1-one (PubChem CID 155148517) has the molecular formula C23H21ClF3N3O3 and a molecular weight of 479.89 g/mol. Its IUPAC name is 1-[4-[4-[[[4-chloro-3-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-2-pyridinyl]-2-methylpropan-1-one.
| Compound Name | 1-[4-[4-[[[4-chloro-3-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-2-pyridinyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 155148517 |
| Molecular Formula | C23H21ClF3N3O3 |
| Molecular Weight | 479.89 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1-[4-[4-[[[4-chloro-3-(trifluoromethyl)anilino]-hydroxymethyl]amino]phenoxy]-2-pyridinyl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)c1cc(Oc2ccc(NC(O)Nc3ccc(Cl)c(C(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C23H21ClF3N3O3/c1-13(2)21(31)20-12-17(9-10-28-20)33-16-6-3-14(4-7-16)29-22(32)30-15-5-8-19(24)18(11-15)23(25,26)27/h3-13,22,29-30,32H,1-2H3 |
| InChIKey | KSLCXQCSXBJFBN-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.89 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|