C25H49ClN6O3 — CID 155150624
3,3-diamino-2-(6-chloro-1-ethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]piperidin-3-yl]propanamide (PubChem CID 155150624) has the molecular formula C25H49ClN6O3 and a molecular weight of 517.16 g/mol. Its IUPAC name is 3,3-diamino-2-(6-chloro-1-ethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(6-chloro-1-ethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 155150624 |
| Molecular Formula | C25H49ClN6O3 |
| Molecular Weight | 517.16 g/mol |
| Exact Mass | 516.36 |
| IUPAC Name | 3,3-diamino-2-(6-chloro-1-ethyl-8-methyl-4-azabicyclo[6.1.0]nonan-3-yl)-N-[4-[2-[2-(dimethylamino)ethoxy]ethoxy]piperidin-3-yl]propanamide |
| SMILES | CCC12CC(C(C(=O)NC3CNCCC3OCCOCCN(C)C)C(N)N)NCC(Cl)CC1(C)C2 |
| InChI | InChI=1S/C25H49ClN6O3/c1-5-25-13-18(30-14-17(26)12-24(25,2)16-25)21(22(27)28)23(33)31-19-15-29-7-6-20(19)35-11-10-34-9-8-32(3)4/h17-22,29-30H,5-16,27-28H2,1-4H3,(H,31,33) |
| InChIKey | WLTHQUBTWIFNTP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 126.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|