C26H47FN5O3+ — CID 123559259
3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6-tetrahydroazonin-1-ium-2-yl)-N-[4-(oxolan-3-yloxy)piperidin-3-yl]propanamide (PubChem CID 123559259) has the molecular formula C26H47FN5O3+ and a molecular weight of 496.69 g/mol. Its IUPAC name is 3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6-tetrahydroazonin-1-ium-2-yl)-N-[4-(oxolan-3-yloxy)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6-tetrahydroazonin-1-ium-2-yl)-N-[4-(oxolan-3-yloxy)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123559259 |
| Molecular Formula | C26H47FN5O3+ |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.37 |
| IUPAC Name | 3,3-diamino-2-(4-ethyl-8-fluoro-1-methyl-4-propyl-2,3,5,6-tetrahydroazonin-1-ium-2-yl)-N-[4-(oxolan-3-yloxy)piperidin-3-yl]propanamide |
| SMILES | CCCC1(CC)CCC=C(F)/C=[N+](/C)C(C(C(=O)NC2CNCCC2OC2CCOC2)C(N)N)C1 |
| InChI | InChI=1S/C26H46FN5O3/c1-4-10-26(5-2)11-6-7-18(27)16-32(3)21(14-26)23(24(28)29)25(33)31-20-15-30-12-8-22(20)35-19-9-13-34-17-19/h7,16,19-24,30H,4-6,8-15,17,28-29H2,1-3H3/p+1/b18-7?,32-16- |
| InChIKey | JRGWULDWYCVLLM-DBAIBTBJSA-O |
| XLogP | 1.81 |
| TPSA | 114.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|