C21H35ClN5O3+ — CID 163981092
3,3-diamino-2-(7-chloro-4-ethyl-1-azoniacycloocta-1,7,8-trien-2-yl)-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]propanamide (PubChem CID 163981092) has the molecular formula C21H35ClN5O3+ and a molecular weight of 441.00 g/mol. Its IUPAC name is 3,3-diamino-2-(7-chloro-4-ethyl-1-azoniacycloocta-1,7,8-trien-2-yl)-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(7-chloro-4-ethyl-1-azoniacycloocta-1,7,8-trien-2-yl)-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 163981092 |
| Molecular Formula | C21H35ClN5O3+ |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 3,3-diamino-2-(7-chloro-4-ethyl-1-azoniacycloocta-1,7,8-trien-2-yl)-N-[4-[(3R)-oxolan-3-yl]oxypiperidin-3-yl]propanamide |
| SMILES | CCC1CCC(Cl)=C=[N+]=C(C(C(=O)NC2CNCCC2O[C@@H]2CCOC2)C(N)N)C1 |
| InChI | InChI=1S/C21H34ClN5O3/c1-2-13-3-4-14(22)10-26-16(9-13)19(20(23)24)21(28)27-17-11-25-7-5-18(17)30-15-6-8-29-12-15/h13,15,17-20,25H,2-9,11-12,23-24H2,1H3/p+1/t13?,15-,17?,18?,19?/m1/s1 |
| InChIKey | WWDSXPLAPONNRA-VRCBGAKOSA-O |
| XLogP | 0.01 |
| TPSA | 125.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|