C17H29FN6O4S — CID 163415935
3,3-diamino-N-[4-(1,1-dioxothian-4-yl)oxypiperidin-3-yl]-2-(5-fluoro-2,5-dihydropyrimidin-2-yl)propanamide (PubChem CID 163415935) has the molecular formula C17H29FN6O4S and a molecular weight of 432.52 g/mol. Its IUPAC name is 3,3-diamino-N-[4-(1,1-dioxothian-4-yl)oxypiperidin-3-yl]-2-(5-fluoro-2,5-dihydropyrimidin-2-yl)propanamide.
| Compound Name | 3,3-diamino-N-[4-(1,1-dioxothian-4-yl)oxypiperidin-3-yl]-2-(5-fluoro-2,5-dihydropyrimidin-2-yl)propanamide |
|---|---|
| PubChem CID | 163415935 |
| Molecular Formula | C17H29FN6O4S |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3,3-diamino-N-[4-(1,1-dioxothian-4-yl)oxypiperidin-3-yl]-2-(5-fluoro-2,5-dihydropyrimidin-2-yl)propanamide |
| SMILES | NC(N)C(C(=O)NC1CNCCC1OC1CCS(=O)(=O)CC1)C1N=CC(F)C=N1 |
| InChI | InChI=1S/C17H29FN6O4S/c18-10-7-22-16(23-8-10)14(15(19)20)17(25)24-12-9-21-4-1-13(12)28-11-2-5-29(26,27)6-3-11/h7-8,10-16,21H,1-6,9,19-20H2,(H,24,25) |
| InChIKey | AEJQNAXYNLMCLG-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 161.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|