C26H50ClN7O — CID 155150607
3,3-diamino-2-(6-butyl-3-chloro-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-[3-(dimethylamino)piperidin-1-yl]piperidin-3-yl]propanamide (PubChem CID 155150607) has the molecular formula C26H50ClN7O and a molecular weight of 512.19 g/mol. Its IUPAC name is 3,3-diamino-2-(6-butyl-3-chloro-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-[3-(dimethylamino)piperidin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(6-butyl-3-chloro-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-[3-(dimethylamino)piperidin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 155150607 |
| Molecular Formula | C26H50ClN7O |
| Molecular Weight | 512.19 g/mol |
| Exact Mass | 511.38 |
| IUPAC Name | 3,3-diamino-2-(6-butyl-3-chloro-1-azabicyclo[4.2.0]octan-8-yl)-N-[4-[3-(dimethylamino)piperidin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CCCCC12CCC(Cl)CN1C(C(C(=O)NC1CNCCC1N1CCCC(N(C)C)C1)C(N)N)C2 |
| InChI | InChI=1S/C26H50ClN7O/c1-4-5-10-26-11-8-18(27)16-34(26)22(14-26)23(24(28)29)25(35)31-20-15-30-12-9-21(20)33-13-6-7-19(17-33)32(2)3/h18-24,30H,4-17,28-29H2,1-3H3,(H,31,35) |
| InChIKey | LDMGYXDZRKOEMG-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 102.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|