C29H52ClN7O — CID 155150939
3,3-diamino-N-[4-[4-(azetidin-1-yl)piperidin-1-yl]-1-pentylpiperidin-3-yl]-2-[(6R)-3-chloro-6-methyl-1-azabicyclo[4.2.0]oct-2-en-8-yl]propanamide (PubChem CID 155150939) has the molecular formula C29H52ClN7O and a molecular weight of 550.24 g/mol. Its IUPAC name is 3,3-diamino-N-[4-[4-(azetidin-1-yl)piperidin-1-yl]-1-pentylpiperidin-3-yl]-2-[(6R)-3-chloro-6-methyl-1-azabicyclo[4.2.0]oct-2-en-8-yl]propanamide.
| Compound Name | 3,3-diamino-N-[4-[4-(azetidin-1-yl)piperidin-1-yl]-1-pentylpiperidin-3-yl]-2-[(6R)-3-chloro-6-methyl-1-azabicyclo[4.2.0]oct-2-en-8-yl]propanamide |
|---|---|
| PubChem CID | 155150939 |
| Molecular Formula | C29H52ClN7O |
| Molecular Weight | 550.24 g/mol |
| Exact Mass | 549.39 |
| IUPAC Name | 3,3-diamino-N-[4-[4-(azetidin-1-yl)piperidin-1-yl]-1-pentylpiperidin-3-yl]-2-[(6R)-3-chloro-6-methyl-1-azabicyclo[4.2.0]oct-2-en-8-yl]propanamide |
| SMILES | CCCCCN1CCC(N2CCC(N3CCC3)CC2)C(NC(=O)C(C(N)N)C2C[C@@]3(C)CCC(Cl)=CN23)C1 |
| InChI | InChI=1S/C29H52ClN7O/c1-3-4-5-12-34-15-10-24(36-16-8-22(9-17-36)35-13-6-14-35)23(20-34)33-28(38)26(27(31)32)25-18-29(2)11-7-21(30)19-37(25)29/h19,22-27H,3-18,20,31-32H2,1-2H3,(H,33,38)/t23?,24?,25?,26?,29-/m1/s1 |
| InChIKey | OSJLOUNGQWSRNW-VBTAHXNJSA-N |
| XLogP | 2.47 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|