C24H45ClN6O2S — CID 138645967
3,3-diamino-2-(6-butyl-3-chloro-6-methyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)-N-[4-(1-oxo-1,4-thiazinan-4-yl)piperidin-3-yl]propanamide (PubChem CID 138645967) has the molecular formula C24H45ClN6O2S and a molecular weight of 517.18 g/mol. Its IUPAC name is 3,3-diamino-2-(6-butyl-3-chloro-6-methyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)-N-[4-(1-oxo-1,4-thiazinan-4-yl)piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(6-butyl-3-chloro-6-methyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)-N-[4-(1-oxo-1,4-thiazinan-4-yl)piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 138645967 |
| Molecular Formula | C24H45ClN6O2S |
| Molecular Weight | 517.18 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 3,3-diamino-2-(6-butyl-3-chloro-6-methyl-3,4,5,7-tetrahydro-2H-azocin-8-yl)-N-[4-(1-oxo-1,4-thiazinan-4-yl)piperidin-3-yl]propanamide |
| SMILES | CCCCC1(C)CCC(Cl)C/N=C(/C(C(=O)NC2CNCCC2N2CCS(=O)CC2)C(N)N)C1 |
| InChI | InChI=1S/C24H45ClN6O2S/c1-3-4-7-24(2)8-5-17(25)15-29-18(14-24)21(22(26)27)23(32)30-19-16-28-9-6-20(19)31-10-12-34(33)13-11-31/h17,19-22,28H,3-16,26-27H2,1-2H3,(H,30,32)/b29-18+ |
| InChIKey | AJGMSUPSWFKJFX-RDRPBHBLSA-N |
| XLogP | 1.19 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|