C28H34N2O4 — CID 155152228
(4aS,7S,7aR,12bS)-3-[(1-hydroxycyclopropyl)methyl]-7-(methylamino)-9-phenylmethoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol (PubChem CID 155152228) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (4aS,7S,7aR,12bS)-3-[(1-hydroxycyclopropyl)methyl]-7-(methylamino)-9-phenylmethoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol.
| Compound Name | (4aS,7S,7aR,12bS)-3-[(1-hydroxycyclopropyl)methyl]-7-(methylamino)-9-phenylmethoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
|---|---|
| PubChem CID | 155152228 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (4aS,7S,7aR,12bS)-3-[(1-hydroxycyclopropyl)methyl]-7-(methylamino)-9-phenylmethoxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-4a-ol |
| SMILES | CN[C@H]1CC[C@@]2(O)C3Cc4ccc(OCc5ccccc5)c5c4[C@@]2(CCN3CC2(O)CC2)[C@H]1O5 |
| InChI | InChI=1S/C28H34N2O4/c1-29-20-9-10-28(32)22-15-19-7-8-21(33-16-18-5-3-2-4-6-18)24-23(19)27(28,25(20)34-24)13-14-30(22)17-26(31)11-12-26/h2-8,20,22,25,29,31-32H,9-17H2,1H3/t20-,22?,25-,27-,28+/m0/s1 |
| InChIKey | PBJSRYADQFXZKC-PRQWLKPKSA-N |
| XLogP | 2.53 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |