C35H42N4O4 — CID 155152586
3-[7-[4-[1-[(2S)-2-amino-3-(4-tert-butylphenyl)propanoyl]piperidin-4-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155152586) has the molecular formula C35H42N4O4 and a molecular weight of 582.75 g/mol. Its IUPAC name is 3-[7-[4-[1-[(2S)-2-amino-3-(4-tert-butylphenyl)propanoyl]piperidin-4-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[4-[1-[(2S)-2-amino-3-(4-tert-butylphenyl)propanoyl]piperidin-4-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155152586 |
| Molecular Formula | C35H42N4O4 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | 3-[7-[4-[1-[(2S)-2-amino-3-(4-tert-butylphenyl)propanoyl]piperidin-4-yl]but-1-ynyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)c1ccc(C[C@H](N)C(=O)N2CCC(CCC#Cc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C35H42N4O4/c1-35(2,3)26-13-11-24(12-14-26)21-29(36)34(43)38-19-17-23(18-20-38)7-4-5-8-25-9-6-10-27-28(25)22-39(33(27)42)30-15-16-31(40)37-32(30)41/h6,9-14,23,29-30H,4,7,15-22,36H2,1-3H3,(H,37,40,41)/t29-,30?/m0/s1 |
| InChIKey | GSLNASDRDSLREW-UFXYQILXSA-N |
| XLogP | 3.69 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|