C19H29NO3S — CID 155152869
N-[2-[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylbutoxy]ethyl]-2-methylprop-2-enamide (PubChem CID 155152869) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is N-[2-[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylbutoxy]ethyl]-2-methylprop-2-enamide.
| Compound Name | N-[2-[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylbutoxy]ethyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 155152869 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-[2-[4-[4-(2-hydroxypropan-2-yl)phenyl]sulfanylbutoxy]ethyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCOCCCCSc1ccc(C(C)(C)O)cc1 |
| InChI | InChI=1S/C19H29NO3S/c1-15(2)18(21)20-11-13-23-12-5-6-14-24-17-9-7-16(8-10-17)19(3,4)22/h7-10,22H,1,5-6,11-14H2,2-4H3,(H,20,21) |
| InChIKey | GPTGTUJGTSAHEP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|