C16H20F3NO3 — CID 86846512
2-(4-tert-butylphenyl)-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide (PubChem CID 86846512) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide.
| Compound Name | 2-(4-tert-butylphenyl)-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 86846512 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2-oxo-N-[2-(2,2,2-trifluoroethoxy)ethyl]acetamide |
| SMILES | CC(C)(C)c1ccc(C(=O)C(=O)NCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO3/c1-15(2,3)12-6-4-11(5-7-12)13(21)14(22)20-8-9-23-10-16(17,18)19/h4-7H,8-10H2,1-3H3,(H,20,22) |
| InChIKey | XDNGVTIMUJCHIZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|