C25H48N2O5 — CID 170180850
2-ethyl-3,3-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]-2-propan-2-ylbutanamide (PubChem CID 170180850) has the molecular formula C25H48N2O5 and a molecular weight of 456.67 g/mol. Its IUPAC name is 2-ethyl-3,3-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]-2-propan-2-ylbutanamide.
| Compound Name | 2-ethyl-3,3-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]-2-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 170180850 |
| Molecular Formula | C25H48N2O5 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 2-ethyl-3,3-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]-2-propan-2-ylbutanamide |
| SMILES | C=C(C)C(=O)NCCCOCCOCCOCCCNC(=O)C(CC)(C(C)C)C(C)(C)C |
| InChI | InChI=1S/C25H48N2O5/c1-9-25(21(4)5,24(6,7)8)23(29)27-13-11-15-31-17-19-32-18-16-30-14-10-12-26-22(28)20(2)3/h21H,2,9-19H2,1,3-8H3,(H,26,28)(H,27,29) |
| InChIKey | CYRDKNTYJYVOMO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|