C24H44N2O5 — CID 166661456
1-tert-butyl-2,2-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]cyclopropane-1-carboxamide (PubChem CID 166661456) has the molecular formula C24H44N2O5 and a molecular weight of 440.63 g/mol. Its IUPAC name is 1-tert-butyl-2,2-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]cyclopropane-1-carboxamide.
| Compound Name | 1-tert-butyl-2,2-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 166661456 |
| Molecular Formula | C24H44N2O5 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 1-tert-butyl-2,2-dimethyl-N-[3-[2-[2-[3-(2-methylprop-2-enoylamino)propoxy]ethoxy]ethoxy]propyl]cyclopropane-1-carboxamide |
| SMILES | C=C(C)C(=O)NCCCOCCOCCOCCCNC(=O)C1(C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C24H44N2O5/c1-19(2)20(27)25-10-8-12-29-14-16-31-17-15-30-13-9-11-26-21(28)24(22(3,4)5)18-23(24,6)7/h1,8-18H2,2-7H3,(H,25,27)(H,26,28) |
| InChIKey | BJYZRQPBMUJZHV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|