C15H29NO2 — CID 142381966
N-[3-(5,5-dimethylhexan-3-yloxy)propyl]-2-methylprop-2-enamide (PubChem CID 142381966) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is N-[3-(5,5-dimethylhexan-3-yloxy)propyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-(5,5-dimethylhexan-3-yloxy)propyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 142381966 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | N-[3-(5,5-dimethylhexan-3-yloxy)propyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCOC(CC)CC(C)(C)C |
| InChI | InChI=1S/C15H29NO2/c1-7-13(11-15(4,5)6)18-10-8-9-16-14(17)12(2)3/h13H,2,7-11H2,1,3-6H3,(H,16,17) |
| InChIKey | XYHJTLWYIDMBIM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|