C33H62N2O8 — CID 158578500
tert-butyl 2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoate;methane;2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoic acid (PubChem CID 158578500) has the molecular formula C33H62N2O8 and a molecular weight of 614.87 g/mol. Its IUPAC name is tert-butyl 2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoate;methane;2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoic acid.
| Compound Name | tert-butyl 2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoate;methane;2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoic acid |
|---|---|
| PubChem CID | 158578500 |
| Molecular Formula | C33H62N2O8 |
| Molecular Weight | 614.87 g/mol |
| Exact Mass | 614.45 |
| IUPAC Name | tert-butyl 2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoate;methane;2-methyl-4-[3-(2-methylprop-2-enoylamino)propoxy]hexanoic acid |
| SMILES | C.C=C(C)C(=O)NCCCOC(CC)CC(C)C(=O)O.C=C(C)C(=O)NCCCOC(CC)CC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO4.C14H25NO4.CH4/c1-8-15(12-14(4)17(21)23-18(5,6)7)22-11-9-10-19-16(20)13(2)3;1-5-12(9-11(4)14(17)18)19-8-6-7-15-13(16)10(2)3;/h14-15H,2,8-12H2,1,3-7H3,(H,19,20);11-12H,2,5-9H2,1,3-4H3,(H,15,16)(H,17,18);1H4 |
| InChIKey | HSYOPYXJVCJJKC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.87 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|