C20H22Cl3NO5S — CID 155153389
N-[3-[3-[[2,4-dichloro-3-(3-chloropropoxy)phenyl]methyl]phenoxy]-2-oxopropyl]methanesulfonamide (PubChem CID 155153389) has the molecular formula C20H22Cl3NO5S and a molecular weight of 494.82 g/mol. Its IUPAC name is N-[3-[3-[[2,4-dichloro-3-(3-chloropropoxy)phenyl]methyl]phenoxy]-2-oxopropyl]methanesulfonamide.
| Compound Name | N-[3-[3-[[2,4-dichloro-3-(3-chloropropoxy)phenyl]methyl]phenoxy]-2-oxopropyl]methanesulfonamide |
|---|---|
| PubChem CID | 155153389 |
| Molecular Formula | C20H22Cl3NO5S |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 493.03 |
| IUPAC Name | N-[3-[3-[[2,4-dichloro-3-(3-chloropropoxy)phenyl]methyl]phenoxy]-2-oxopropyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC(=O)COc1cccc(Cc2ccc(Cl)c(OCCCCl)c2Cl)c1 |
| InChI | InChI=1S/C20H22Cl3NO5S/c1-30(26,27)24-12-16(25)13-29-17-5-2-4-14(11-17)10-15-6-7-18(22)20(19(15)23)28-9-3-8-21/h2,4-7,11,24H,3,8-10,12-13H2,1H3 |
| InChIKey | LZSZREYVGOYHAT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|