C22H26Cl3NO6S — CID 153368186
1-[4-[3-[3,5-dichloro-4-(3-chloropropoxy)phenyl]oxetan-3-yl]phenoxy]-3-[[dihydroxy(methyl)-λ4-sulfanyl]amino]propan-2-one (PubChem CID 153368186) has the molecular formula C22H26Cl3NO6S and a molecular weight of 538.88 g/mol. Its IUPAC name is 1-[4-[3-[3,5-dichloro-4-(3-chloropropoxy)phenyl]oxetan-3-yl]phenoxy]-3-[[dihydroxy(methyl)-λ4-sulfanyl]amino]propan-2-one.
| Compound Name | 1-[4-[3-[3,5-dichloro-4-(3-chloropropoxy)phenyl]oxetan-3-yl]phenoxy]-3-[[dihydroxy(methyl)-λ4-sulfanyl]amino]propan-2-one |
|---|---|
| PubChem CID | 153368186 |
| Molecular Formula | C22H26Cl3NO6S |
| Molecular Weight | 538.88 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | 1-[4-[3-[3,5-dichloro-4-(3-chloropropoxy)phenyl]oxetan-3-yl]phenoxy]-3-[[dihydroxy(methyl)-λ4-sulfanyl]amino]propan-2-one |
| SMILES | CS(O)(O)NCC(=O)COc1ccc(C2(c3cc(Cl)c(OCCCCl)c(Cl)c3)COC2)cc1 |
| InChI | InChI=1S/C22H26Cl3NO6S/c1-33(28,29)26-11-17(27)12-32-18-5-3-15(4-6-18)22(13-30-14-22)16-9-19(24)21(20(25)10-16)31-8-2-7-23/h3-6,9-10,26,28-29H,2,7-8,11-14H2,1H3 |
| InChIKey | KKBQSGJGHZLOCW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|