C21H23Cl3N2O6S — CID 156534486
2-[[4-[3,5-dichloro-4-(3-chloropropoxy)anilino]phenoxy]methyl]prop-2-enyl-methylsulfonylcarbamic acid (PubChem CID 156534486) has the molecular formula C21H23Cl3N2O6S and a molecular weight of 537.85 g/mol. Its IUPAC name is 2-[[4-[3,5-dichloro-4-(3-chloropropoxy)anilino]phenoxy]methyl]prop-2-enyl-methylsulfonylcarbamic acid.
| Compound Name | 2-[[4-[3,5-dichloro-4-(3-chloropropoxy)anilino]phenoxy]methyl]prop-2-enyl-methylsulfonylcarbamic acid |
|---|---|
| PubChem CID | 156534486 |
| Molecular Formula | C21H23Cl3N2O6S |
| Molecular Weight | 537.85 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | 2-[[4-[3,5-dichloro-4-(3-chloropropoxy)anilino]phenoxy]methyl]prop-2-enyl-methylsulfonylcarbamic acid |
| SMILES | C=C(COc1ccc(Nc2cc(Cl)c(OCCCCl)c(Cl)c2)cc1)CN(C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C21H23Cl3N2O6S/c1-14(12-26(21(27)28)33(2,29)30)13-32-17-6-4-15(5-7-17)25-16-10-18(23)20(19(24)11-16)31-9-3-8-22/h4-7,10-11,25H,1,3,8-9,12-13H2,2H3,(H,27,28) |
| InChIKey | WZVHBEZPNXPOHK-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.85 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|