C18H34O4Si — CID 15515436
1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxol-3a-yl]propan-2-one (PubChem CID 15515436) has the molecular formula C18H34O4Si and a molecular weight of 342.55 g/mol. Its IUPAC name is 1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxol-3a-yl]propan-2-one.
| Compound Name | 1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxol-3a-yl]propan-2-one |
|---|---|
| PubChem CID | 15515436 |
| Molecular Formula | C18H34O4Si |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 1-[(3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-5,6,7,7a-tetrahydro-4H-1,3-benzodioxol-3a-yl]propan-2-one |
| SMILES | CC(=O)C[C@@]12OC(C)(C)O[C@@H]1CCC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34O4Si/c1-13(19)12-18-14(20-17(5,6)22-18)10-9-11-15(18)21-23(7,8)16(2,3)4/h14-15H,9-12H2,1-8H3/t14-,15+,18-/m1/s1 |
| InChIKey | COLNRSCPUKYLBB-RVKKMQEKSA-N |
| XLogP | 4.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|