C22H44O5Si2 — CID 101205879
(3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one (PubChem CID 101205879) has the molecular formula C22H44O5Si2 and a molecular weight of 444.76 g/mol. Its IUPAC name is (3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one.
| Compound Name | (3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 101205879 |
| Molecular Formula | C22H44O5Si2 |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | (3aR,4R,7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-one |
| SMILES | CC1(C)O[C@H]2[C@H](O1)[C@@H](CO[Si](C)(C)C(C)(C)C)C(=O)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O5Si2/c1-20(2,3)28(9,10)24-14-15-16(23)13-17(27-29(11,12)21(4,5)6)19-18(15)25-22(7,8)26-19/h15,17-19H,13-14H2,1-12H3/t15-,17-,18+,19+/m0/s1 |
| InChIKey | GTPIFVMRMMSDLF-GDAAHCPNSA-N |
| XLogP | 5.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|