C17H34O5Si — CID 134836947
1-[(1S,2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-(methoxymethoxy)cyclohexyl]ethanone (PubChem CID 134836947) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is 1-[(1S,2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-(methoxymethoxy)cyclohexyl]ethanone.
| Compound Name | 1-[(1S,2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-(methoxymethoxy)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 134836947 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | 1-[(1S,2R,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-4-(methoxymethoxy)cyclohexyl]ethanone |
| SMILES | COCO[C@H]1CC[C@H](C(C)=O)[C@@H](OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-12(18)13-9-10-14(21-11-19-5)16(15(13)20-6)22-23(7,8)17(2,3)4/h13-16H,9-11H2,1-8H3/t13-,14+,15-,16-/m1/s1 |
| InChIKey | PKEGFUCSNSCJLS-QKPAOTATSA-N |
| XLogP | 3.38 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|