C15H11ClN4 — CID 155154571
6-[(2-chloro-4-methylbenzimidazol-1-yl)methyl]pyridine-3-carbonitrile (PubChem CID 155154571) has the molecular formula C15H11ClN4 and a molecular weight of 282.73 g/mol. Its IUPAC name is 6-[(2-chloro-4-methylbenzimidazol-1-yl)methyl]pyridine-3-carbonitrile.
| Compound Name | 6-[(2-chloro-4-methylbenzimidazol-1-yl)methyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 155154571 |
| Molecular Formula | C15H11ClN4 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6-[(2-chloro-4-methylbenzimidazol-1-yl)methyl]pyridine-3-carbonitrile |
| SMILES | Cc1cccc2c1nc(Cl)n2Cc1ccc(C#N)cn1 |
| InChI | InChI=1S/C15H11ClN4/c1-10-3-2-4-13-14(10)19-15(16)20(13)9-12-6-5-11(7-17)8-18-12/h2-6,8H,9H2,1H3 |
| InChIKey | ODFPHGMWXWUMQZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |