C8H12ClNO — CID 155160330
1-chloroethyl N-[(1E)-buta-1,3-dienyl]ethanimidate (PubChem CID 155160330) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is 1-chloroethyl N-[(1E)-buta-1,3-dienyl]ethanimidate.
| Compound Name | 1-chloroethyl N-[(1E)-buta-1,3-dienyl]ethanimidate |
|---|---|
| PubChem CID | 155160330 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 1-chloroethyl N-[(1E)-buta-1,3-dienyl]ethanimidate |
| SMILES | C=C/C=C/N=C(\C)OC(C)Cl |
| InChI | InChI=1S/C8H12ClNO/c1-4-5-6-10-8(3)11-7(2)9/h4-7H,1H2,2-3H3/b6-5+,10-8+ |
| InChIKey | LMEMQBNUTPPLIC-FTKIWFIZSA-N |
| XLogP | 2.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|