C13H17NO — CID 168922017
[(3E)-hexa-1,3,5-trien-3-yl] N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimidate (PubChem CID 168922017) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl] N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimidate.
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl] N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimidate |
|---|---|
| PubChem CID | 168922017 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl] N-[(1Z)-3-methylbuta-1,3-dienyl]ethanimidate |
| SMILES | C=C/C=C(\C=C)O/C(C)=N/C=C\C(=C)C |
| InChI | InChI=1S/C13H17NO/c1-6-8-13(7-2)15-12(5)14-10-9-11(3)4/h6-10H,1-3H2,4-5H3/b10-9-,13-8+,14-12+ |
| InChIKey | IAMMQEZYHHKQPP-QGWQWDGUSA-N |
| XLogP | 3.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|