C25H35ClN2 — CID 155160518
1-[(4-tert-butylphenyl)methyl]-4-[(2-chloro-5-propan-2-ylphenyl)methyl]piperazine (PubChem CID 155160518) has the molecular formula C25H35ClN2 and a molecular weight of 399.02 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-4-[(2-chloro-5-propan-2-ylphenyl)methyl]piperazine.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-4-[(2-chloro-5-propan-2-ylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 155160518 |
| Molecular Formula | C25H35ClN2 |
| Molecular Weight | 399.02 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-4-[(2-chloro-5-propan-2-ylphenyl)methyl]piperazine |
| SMILES | CC(C)c1ccc(Cl)c(CN2CCN(Cc3ccc(C(C)(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C25H35ClN2/c1-19(2)21-8-11-24(26)22(16-21)18-28-14-12-27(13-15-28)17-20-6-9-23(10-7-20)25(3,4)5/h6-11,16,19H,12-15,17-18H2,1-5H3 |
| InChIKey | KPKFVWUCRKELLR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.02 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |