C27H27ClF3N7O4 — CID 155165607
5-(4-chlorophenyl)-2-[[1-[2-(3-methoxypiperidine-1-carbonyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one (PubChem CID 155165607) has the molecular formula C27H27ClF3N7O4 and a molecular weight of 606.01 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[1-[2-(3-methoxypiperidine-1-carbonyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one.
| Compound Name | 5-(4-chlorophenyl)-2-[[1-[2-(3-methoxypiperidine-1-carbonyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 155165607 |
| Molecular Formula | C27H27ClF3N7O4 |
| Molecular Weight | 606.01 g/mol |
| Exact Mass | 605.18 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[1-[2-(3-methoxypiperidine-1-carbonyl)phenyl]-1,2,4-triazol-3-yl]methyl]-4-[(2S)-3,3,3-trifluoro-2-hydroxypropyl]-1,2,4-triazol-3-one |
| SMILES | COC1CCCN(C(=O)c2ccccc2-n2cnc(Cn3nc(-c4ccc(Cl)cc4)n(C[C@H](O)C(F)(F)F)c3=O)n2)C1 |
| InChI | InChI=1S/C27H27ClF3N7O4/c1-42-19-5-4-12-35(13-19)25(40)20-6-2-3-7-21(20)38-16-32-23(33-38)15-37-26(41)36(14-22(39)27(29,30)31)24(34-37)17-8-10-18(28)11-9-17/h2-3,6-11,16,19,22,39H,4-5,12-15H2,1H3/t19?,22-/m0/s1 |
| InChIKey | DBORBJLCASEQTK-BPARTEKVSA-N |
| XLogP | 3.17 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.01 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |