C20H23IN2O4S2 — CID 155169521
N-[4-(2-ethylthiomorpholin-4-yl)sulfonylphenyl]-3-iodo-4-methoxybenzamide (PubChem CID 155169521) has the molecular formula C20H23IN2O4S2 and a molecular weight of 546.45 g/mol. Its IUPAC name is N-[4-(2-ethylthiomorpholin-4-yl)sulfonylphenyl]-3-iodo-4-methoxybenzamide.
| Compound Name | N-[4-(2-ethylthiomorpholin-4-yl)sulfonylphenyl]-3-iodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 155169521 |
| Molecular Formula | C20H23IN2O4S2 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | N-[4-(2-ethylthiomorpholin-4-yl)sulfonylphenyl]-3-iodo-4-methoxybenzamide |
| SMILES | CCC1CN(S(=O)(=O)c2ccc(NC(=O)c3ccc(OC)c(I)c3)cc2)CCS1 |
| InChI | InChI=1S/C20H23IN2O4S2/c1-3-16-13-23(10-11-28-16)29(25,26)17-7-5-15(6-8-17)22-20(24)14-4-9-19(27-2)18(21)12-14/h4-9,12,16H,3,10-11,13H2,1-2H3,(H,22,24) |
| InChIKey | DRTHQYVRBVHKGC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|