C25H32N2O6 — CID 155169840
methyl 3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxoimidazolidin-1-yl]methyl]benzoate (PubChem CID 155169840) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is methyl 3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxoimidazolidin-1-yl]methyl]benzoate.
| Compound Name | methyl 3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxoimidazolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 155169840 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | methyl 3-methoxy-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxoimidazolidin-1-yl]methyl]benzoate |
| SMILES | CCCCCOc1cc(N2CCN(Cc3ccc(C(=O)OC)cc3OC)C2=O)ccc1OC |
| InChI | InChI=1S/C25H32N2O6/c1-5-6-7-14-33-23-16-20(10-11-21(23)30-2)27-13-12-26(25(27)29)17-19-9-8-18(24(28)32-4)15-22(19)31-3/h8-11,15-16H,5-7,12-14,17H2,1-4H3 |
| InChIKey | PNQAVFPZMLDCGM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|