C27H36N2O5 — CID 155704476
2-[3-ethyl-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]phenyl]acetic acid (PubChem CID 155704476) has the molecular formula C27H36N2O5 and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-[3-ethyl-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]phenyl]acetic acid.
| Compound Name | 2-[3-ethyl-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 155704476 |
| Molecular Formula | C27H36N2O5 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 2-[3-ethyl-4-[[3-(4-methoxy-3-pentoxyphenyl)-2-oxo-1,3-diazinan-1-yl]methyl]phenyl]acetic acid |
| SMILES | CCCCCOc1cc(N2CCCN(Cc3ccc(CC(=O)O)cc3CC)C2=O)ccc1OC |
| InChI | InChI=1S/C27H36N2O5/c1-4-6-7-15-34-25-18-23(11-12-24(25)33-3)29-14-8-13-28(27(29)32)19-22-10-9-20(17-26(30)31)16-21(22)5-2/h9-12,16,18H,4-8,13-15,17,19H2,1-3H3,(H,30,31) |
| InChIKey | HDCRGTUEWDWRDA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|